* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUNOLOL |
| CAS: | 27591-01-1 |
| English Synonyms: | BUNOLOL |
| MDL Number.: | MFCD00864585 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)NCC(COc1cccc2c1CCCC2=O)O |
| InChi: | InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3 |
| InChiKey: | InChIKey=IXHBTMCLRNMKHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.