* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUFROLIN |
| CAS: | 54867-56-0 |
| English Synonyms: | BUFROLIN |
| MDL Number.: | MFCD00864619 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CCCCc1cc2c(=O)cc([nH]c2c3c1[nH]c(cc3=O)C(=O)O)C(=O)O |
| InChi: | InChI=1S/C18H16N2O6/c1-2-3-4-8-5-9-12(21)6-10(17(23)24)20-16(9)14-13(22)7-11(18(25)26)19-15(8)14/h5-7H,2-4H2,1H3,(H,19,22)(H,20,21)(H,23,24)(H,25,26) |
| InChiKey: | InChIKey=BQVIONBNDNFCCP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.