* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BARMASTINE |
| CAS: | 99156-66-8 |
| English Synonyms: | BARMASTINE |
| MDL Number.: | MFCD00864643 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | Cc1c(c(=O)n2ccccc2n1)CCN3CCC(CC3)Nc4nc5cccnc5n4Cc6ccco6 |
| InChi: | InChI=1S/C27H29N7O2/c1-19-22(26(35)33-13-3-2-8-24(33)29-19)11-16-32-14-9-20(10-15-32)30-27-31-23-7-4-12-28-25(23)34(27)18-21-6-5-17-36-21/h2-8,12-13,17,20H,9-11,14-16,18H2,1H3,(H,30,31) |
| InChiKey: | InChIKey=LNSHWIZFFHXFPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.