* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LESOPITRON |
| CAS: | 132449-46-8 |
| English Synonyms: | LESOPITRON |
| MDL Number.: | MFCD00864696 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1cnc(nc1)N2CCN(CC2)CCCCn3cc(cn3)Cl |
| InChi: | InChI=1S/C15H21ClN6/c16-14-12-19-22(13-14)7-2-1-6-20-8-10-21(11-9-20)15-17-4-3-5-18-15/h3-5,12-13H,1-2,6-11H2 |
| InChiKey: | InChIKey=AHCPKWJUALHOPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.