* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROPITOIN |
CAS: | 56079-81-3 |
English Synonyms: | ROPITOIN |
MDL Number.: | MFCD00864720 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)C2(C(=O)N(C(=O)N2)CCCN3CCC(CC3)c4ccccc4)c5ccccc5 |
InChi: | InChI=1S/C30H33N3O3/c1-36-27-15-13-26(14-16-27)30(25-11-6-3-7-12-25)28(34)33(29(35)31-30)20-8-19-32-21-17-24(18-22-32)23-9-4-2-5-10-23/h2-7,9-16,24H,8,17-22H2,1H3,(H,31,35) |
InChiKey: | InChIKey=QAKVGHCHHKKDBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.