* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINDONIUM BROMIDE |
| CAS: | 130-81-4 |
| English Synonyms: | QUINDONIUM BROMIDE |
| MDL Number.: | MFCD00864727 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1O)CC[N+]3=C2CCC4C3CCC4.[Br-] |
| InChi: | InChI=1S/C16H19NO.BrH/c18-13-5-6-14-12(10-13)8-9-17-15-3-1-2-11(15)4-7-16(14)17;/h5-6,10-11,15H,1-4,7-9H2;1H |
| InChiKey: | InChIKey=OUILVKYDBNPYBM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.