* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUFETOLOL |
| CAS: | 53684-49-4 |
| English Synonyms: | BUFETOLOL |
| MDL Number.: | MFCD00864763 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)NCC(COc1ccccc1OCC2CCCO2)O |
| InChi: | InChI=1S/C18H29NO4/c1-18(2,3)19-11-14(20)12-22-16-8-4-5-9-17(16)23-13-15-7-6-10-21-15/h4-5,8-9,14-15,19-20H,6-7,10-13H2,1-3H3 |
| InChiKey: | InChIKey=AKLNLVOZXMQGSI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.