* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MODIPAFANT |
CAS: | 122957-06-6 |
English Synonyms: | MODIPAFANT |
MDL Number.: | MFCD00864793 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=C([C@H]1c2ccccc2Cl)C(=O)Nc3ccccn3)C)c4ccc(cc4)n5c(nc6c5ccnc6)C |
InChi: | InChI=1S/C34H29ClN6O3/c1-4-44-34(43)31-30(24-9-5-6-10-25(24)35)29(33(42)40-28-11-7-8-17-37-28)20(2)38-32(31)22-12-14-23(15-13-22)41-21(3)39-26-19-36-18-16-27(26)41/h5-19,30,38H,4H2,1-3H3,(H,37,40,42)/t30-/m1/s1 |
InChiKey: | InChIKey=ODRYSCQFUGFOSU-SSEXGKCCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.