* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XIBORNOL |
| CAS: | 13741-18-9 |
| English Synonyms: | XIBORNOL |
| MDL Number.: | MFCD00864988 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1cc(c(cc1C)O)C2CC3CCC2(C3(C)C)C |
| InChi: | InChI=1S/C18H26O/c1-11-8-14(16(19)9-12(11)2)15-10-13-6-7-18(15,5)17(13,3)4/h8-9,13,15,19H,6-7,10H2,1-5H3 |
| InChiKey: | InChIKey=RNRHMQWZFJXKLZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.