* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ROLITETRACYCLINE |
| CAS: | 751-97-3 |
| English Synonyms: | ROLITETRACYCLINE |
| MDL Number.: | MFCD00864995 |
| H bond acceptor: | 11 |
| H bond donor: | 6 |
| Smile: | C[C@]1(c2cccc(c2C(=O)C3=C([C@]4([C@@H](C[C@@H]31)[C@@H](C(=C(C4=O)C(=O)NCN5CCCC5)O)N(C)C)O)O)O)O |
| InChi: | InChI=1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14-,15-,20-,26+,27-/m0/s1 |
| InChiKey: | InChIKey=HMEYVGGHISAPJR-IAHYZSEUSA-N |
|
|
| Comments: | RTECS: QI9150000 UNSPSC: 51000000 WGK: 1 |
| Specification: | ANALYTICAL STANDARD |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.