* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BACMECILLINAM |
| CAS: | 50846-45-2 |
| English Synonyms: | BACMECILLINAM |
| MDL Number.: | MFCD00865006 |
| H bond acceptor: | 9 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)OC(C)OC(=O)[C@H]1C(S[C@H]2N1C(=O)[C@H]2/N=C/N3CCCCCC3)(C)C |
| InChi: | InChI=1S/C20H31N3O6S/c1-5-27-19(26)29-13(2)28-18(25)15-20(3,4)30-17-14(16(24)23(15)17)21-12-22-10-8-6-7-9-11-22/h12-15,17H,5-11H2,1-4H3/b21-12+/t13?,14-,15+,17-/m1/s1 |
| InChiKey: | InChIKey=XHKFBADIZIDYBU-MLFVOLAISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.