* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BROXALDINE |
| CAS: | 3684-46-6 |
| English Synonyms: | BROXALDINE |
| MDL Number.: | MFCD00865040 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1ccc2c(cc(c(c2n1)OC(=O)c3ccccc3)Br)Br |
| InChi: | InChI=1S/C17H11Br2NO2/c1-10-7-8-12-13(18)9-14(19)16(15(12)20-10)22-17(21)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChiKey: | InChIKey=IJTPLVAAROHGGB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.