* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTIKACIN |
| CAS: | 59733-86-7 |
| English Synonyms: | BUTIKACIN |
| MDL Number.: | MFCD00865042 |
| H bond acceptor: | 17 |
| H bond donor: | 13 |
| Smile: | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC[C@H](CCN)O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N |
| InChi: | InChI=1S/C22H45N5O12/c23-2-1-7(29)5-27-9-3-8(25)19(38-22-17(34)16(33)14(31)10(4-24)36-22)18(35)20(9)39-21-15(32)12(26)13(30)11(6-28)37-21/h7-22,27-35H,1-6,23-26H2/t7-,8-,9+,10+,11+,12-,13+,14+,15+,16-,17+,18-,19+,20-,21+,22+/m0/s1 |
| InChiKey: | InChIKey=OCFOTEIMZBKQFS-DGMGPCKZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.