* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLOXIMONAM |
| CAS: | 90850-05-8 |
| English Synonyms: | GLOXIMONAM |
| MDL Number.: | MFCD00865085 |
| H bond acceptor: | 13 |
| H bond donor: | 2 |
| Smile: | C[C@H]1[C@@H](C(=O)N1OCC(=O)OCC(=O)OC(C)(C)C)NC(=O)/C(=N\OC)/c2csc(n2)N |
| InChi: | InChI=1S/C18H25N5O8S/c1-9-13(21-15(26)14(22-28-5)10-8-32-17(19)20-10)16(27)23(9)30-7-11(24)29-6-12(25)31-18(2,3)4/h8-9,13H,6-7H2,1-5H3,(H2,19,20)(H,21,26)/b22-14-/t9-,13-/m0/s1 |
| InChiKey: | InChIKey=QPWVHJDIDXILDG-SSUKDTCJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.