* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXYCILIPINE |
| CAS: | 4354-45-4 |
| English Synonyms: | OXYCILIPINE ; OXYCLIPINE |
| MDL Number.: | MFCD00865163 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CN1CCCC(C1)OC(=O)C(c2ccccc2)(C3CCCCC3)O |
| InChi: | InChI=1S/C20H29NO3/c1-21-14-8-13-18(15-21)24-19(22)20(23,16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2,4-5,9-10,17-18,23H,3,6-8,11-15H2,1H3 |
| InChiKey: | InChIKey=LCFBCKSQWVQIBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.