* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENMETOZOLE |
CAS: | 41473-09-0 |
English Synonyms: | FENMETOZOLE |
MDL Number.: | MFCD00865392 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1OCC2=NCCN2)Cl)Cl |
InChi: | InChI=1S/C10H10Cl2N2O/c11-8-2-1-7(5-9(8)12)15-6-10-13-3-4-14-10/h1-2,5H,3-4,6H2,(H,13,14) |
InChiKey: | InChIKey=FVHAONUKSUFJKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.