* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LOFEPRAMINE |
CAS: | 26786-32-3 ;23047-25-8 |
English Synonyms: | LOFEPRAMINE ; LOPRAMINE |
MDL Number.: | MFCD00865465 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CN(CCCN1c2ccccc2CCc3c1cccc3)CC(=O)c4ccc(cc4)Cl |
InChi: | InChI=1S/C26H27ClN2O/c1-28(19-26(30)22-13-15-23(27)16-14-22)17-6-18-29-24-9-4-2-7-20(24)11-12-21-8-3-5-10-25(21)29/h2-5,7-10,13-16H,6,11-12,17-19H2,1H3 |
InChiKey: | InChIKey=SAPNXPWPAUFAJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.