* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLIAMILIDE |
| CAS: | 51876-98-3 |
| English Synonyms: | GLIAMILIDE |
| MDL Number.: | MFCD00865492 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | COc1c(cccn1)C(=O)NCCC2CCN(CC2)S(=O)(=O)NC(=O)NCC3CC4CC3C=C4 |
| InChi: | InChI=1S/C23H33N5O5S/c1-33-22-20(3-2-9-25-22)21(29)24-10-6-16-7-11-28(12-8-16)34(31,32)27-23(30)26-15-19-14-17-4-5-18(19)13-17/h2-5,9,16-19H,6-8,10-15H2,1H3,(H,24,29)(H2,26,27,30) |
| InChiKey: | InChIKey=MQQJZPWSYVPWPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.