* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLISOXEPIDE |
| CAS: | 25046-79-1 |
| English Synonyms: | GLISOXEPID ; GLISOXEPIDE |
| MDL Number.: | MFCD00865498 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | Cc1cc(no1)C(=O)NCCc2ccc(cc2)S(=O)(=O)NC(=O)NN3CCCCCC3 |
| InChi: | InChI=1S/C20H27N5O5S/c1-15-14-18(23-30-15)19(26)21-11-10-16-6-8-17(9-7-16)31(28,29)24-20(27)22-25-12-4-2-3-5-13-25/h6-9,14H,2-5,10-13H2,1H3,(H,21,26)(H2,22,24,27) |
| InChiKey: | InChIKey=ZKUDBRCEOBOWLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.