* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROLGAMIDINE |
CAS: | 66608-04-6 |
English Synonyms: | ROLGAMIDINE |
MDL Number.: | MFCD00865524 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C[C@@H]1C=C[C@H](N1CC(=O)N=C(N)N)C |
InChi: | InChI=1S/C9H16N4O/c1-6-3-4-7(2)13(6)5-8(14)12-9(10)11/h3-4,6-7H,5H2,1-2H3,(H4,10,11,12,14)/t6-,7-/m1/s1 |
InChiKey: | InChIKey=QHMGFQBUOCYLDT-RNFRBKRXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.