* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SILICRISTIN |
| CAS: | 33889-69-9 |
| English Synonyms: | SILICRISTIN |
| MDL Number.: | MFCD00865643 |
| H bond acceptor: | 10 |
| H bond donor: | 6 |
| Smile: | COc1cc(ccc1O)C2C(c3cc(cc(c3O2)O)C4C(C(=O)c5c(cc(cc5O4)O)O)O)CO |
| InChi: | InChI=1S/C25H22O10/c1-33-18-6-10(2-3-15(18)28)23-14(9-26)13-4-11(5-17(30)25(13)35-23)24-22(32)21(31)20-16(29)7-12(27)8-19(20)34-24/h2-8,14,22-24,26-30,32H,9H2,1H3 |
| InChiKey: | InChIKey=BMLIIPOXVWESJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.