* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROCASTINE |
CAS: | 91833-77-1 |
English Synonyms: | ROCASTINE |
MDL Number.: | MFCD00865705 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CN1CC(Oc2c(cccn2)C1=S)CCN(C)C |
InChi: | InChI=1S/C13H19N3OS/c1-15(2)8-6-10-9-16(3)13(18)11-5-4-7-14-12(11)17-10/h4-5,7,10H,6,8-9H2,1-3H3 |
InChiKey: | InChIKey=DPPDPATYPQFYDL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.