* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SITOFIBRATE |
| CAS: | 55902-94-8 |
| English Synonyms: | SITOFIBRATE |
| MDL Number.: | MFCD00865756 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCC(CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C(C)(C)Oc5ccc(cc5)Cl)C)C)C(C)C |
| InChi: | InChI=1S/C39H59ClO3/c1-9-27(25(2)3)11-10-26(4)33-18-19-34-32-17-12-28-24-31(20-22-38(28,7)35(32)21-23-39(33,34)8)42-36(41)37(5,6)43-30-15-13-29(40)14-16-30/h12-16,25-27,31-35H,9-11,17-24H2,1-8H3/t26-,27?,31+,32+,33-,34+,35+,38+,39-/m1/s1 |
| InChiKey: | InChIKey=AKGJIVJDHCUPMI-BIYSRJQWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.