* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLAVODILOL |
CAS: | 79619-31-1 |
English Synonyms: | FLAVODILOL |
MDL Number.: | MFCD00865823 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCNCC(COc1ccc2c(=O)cc(oc2c1)c3ccccc3)O |
InChi: | InChI=1S/C21H23NO4/c1-2-10-22-13-16(23)14-25-17-8-9-18-19(24)12-20(26-21(18)11-17)15-6-4-3-5-7-15/h3-9,11-12,16,22-23H,2,10,13-14H2,1H3 |
InChiKey: | InChIKey=KRBRHCLLOOCWQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.