* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROMERGOLINE |
CAS: | 107052-56-2 |
English Synonyms: | ROMERGOLINE |
MDL Number.: | MFCD00865834 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CN1C[C@@H](C=C2[C@H]1Cc3c[nH]c4c3c2ccc4)CN5CC(=O)NC(=O)C5 |
InChi: | InChI=1S/C20H22N4O2/c1-23-8-12(9-24-10-18(25)22-19(26)11-24)5-15-14-3-2-4-16-20(14)13(7-21-16)6-17(15)23/h2-5,7,12,17,21H,6,8-11H2,1H3,(H,22,25,26)/t12-,17-/m1/s1 |
InChiKey: | InChIKey=RJCXNCSJGRUWRW-SJKOYZFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.