* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDORENATE |
| CAS: | 73758-06-2 ;79754-82-8 |
| English Synonyms: | INDORENATE |
| MDL Number.: | MFCD00865885 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | COc1ccc2c(c1)c(c[nH]2)C(CN)C(=O)OC |
| InChi: | InChI=1S/C13H16N2O3/c1-17-8-3-4-12-9(5-8)11(7-15-12)10(6-14)13(16)18-2/h3-5,7,10,15H,6,14H2,1-2H3 |
| InChiKey: | InChIKey=YFEDJMLMWJSRJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.