* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOSIN |
| CAS: | 15793-38-1 |
| English Synonyms: | QUINAZOSIN |
| MDL Number.: | MFCD00865911 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(cc1OC)nc(nc2N)N3CCN(CC3)CC=C |
| InChi: | InChI=1S/C17H23N5O2/c1-4-5-21-6-8-22(9-7-21)17-19-13-11-15(24-3)14(23-2)10-12(13)16(18)20-17/h4,10-11H,1,5-9H2,2-3H3,(H2,18,19,20) |
| InChiKey: | InChIKey=HSIPLPKNLDWHSE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.