* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FLUTONIDINE |
CAS: | 28125-87-3 |
English Synonyms: | FLUTONIDINE |
MDL Number.: | MFCD00865922 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1NC2=NCCN2)F |
InChi: | InChI=1S/C10H12FN3/c1-7-2-3-8(11)6-9(7)14-10-12-4-5-13-10/h2-3,6H,4-5H2,1H3,(H2,12,13,14) |
InChiKey: | InChIKey=UYIZEUBMWCOJFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.