* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUANOCLOR |
CAS: | 5001-32-1 |
English Synonyms: | GUANOCLOR |
MDL Number.: | MFCD00865947 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | c1cc(c(c(c1)Cl)OCCNNC(=N)N)Cl |
InChi: | InChI=1S/C9H12Cl2N4O/c10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13/h1-3,14H,4-5H2,(H4,12,13,15) |
InChiKey: | InChIKey=XIHXRRMCNSMUET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.