* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUABENXAN |
CAS: | 19889-45-3 |
English Synonyms: | GUABENXAN |
MDL Number.: | MFCD00865971 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc2c(cc1CNC(=N)N)OCCO2 |
InChi: | InChI=1S/C10H13N3O2/c11-10(12)13-6-7-1-2-8-9(5-7)15-4-3-14-8/h1-2,5H,3-4,6H2,(H4,11,12,13) |
InChiKey: | InChIKey=WTDYJDLUNYALPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.