* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FLUPROFEN |
CAS: | 17692-38-5 |
English Synonyms: | FLUPROFEN |
MDL Number.: | MFCD00866060 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(c1ccc(cc1)c2cccc(c2)F)C(=O)O |
InChi: | InChI=1S/C15H13FO2/c1-10(15(17)18)11-5-7-12(8-6-11)13-3-2-4-14(16)9-13/h2-10H,1H3,(H,17,18) |
InChiKey: | InChIKey=TYCOFFBAZNSQOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.