* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FLUNOXAPROFEN |
CAS: | 51234-27-6 |
English Synonyms: | FLUNOXAPROFEN |
MDL Number.: | MFCD00866121 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(c1ccc2c(c1)nc(o2)c3ccc(cc3)F)C(=O)O |
InChi: | InChI=1S/C16H12FNO3/c1-9(16(19)20)11-4-7-14-13(8-11)18-15(21-14)10-2-5-12(17)6-3-10/h2-9H,1H3,(H,19,20) |
InChiKey: | InChIKey=ARPYQKTVRGFPIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.