* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RIMEXOLONE |
CAS: | 49697-38-3 |
English Synonyms: | RIMEXOLONE |
MDL Number.: | MFCD00866123 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(=O)[C@]1([C@@H](C[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)C)C |
InChi: | InChI=1S/C24H34O3/c1-6-20(27)24(5)14(2)11-18-17-8-7-15-12-16(25)9-10-22(15,3)21(17)19(26)13-23(18,24)4/h9-10,12,14,17-19,21,26H,6-8,11,13H2,1-5H3/t14-,17+,18+,19+,21-,22+,23+,24-/m1/s1 |
InChiKey: | InChIKey=QTTRZHGPGKRAFB-OOKHYKNYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.