* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DEXINDOPROFEN |
| CAS: | 53086-13-8 |
| English Synonyms: | DEXINDOPROFEN |
| MDL Number.: | MFCD00866134 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C[C@@H](c1ccc(cc1)N2Cc3ccccc3C2=O)C(=O)O |
| InChi: | InChI=1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChiKey: | InChIKey=RJMIEHBSYVWVIN-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.