* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RAXOFELAST |
CAS: | 128232-14-4 |
English Synonyms: | RAXOFELAST |
MDL Number.: | MFCD00866136 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1c(c(c(c2c1OC(C2)CC(=O)O)C)OC(=O)C)C |
InChi: | InChI=1S/C15H18O5/c1-7-8(2)15-12(5-11(20-15)6-13(17)18)9(3)14(7)19-10(4)16/h11H,5-6H2,1-4H3,(H,17,18) |
InChiKey: | InChIKey=QLWBKUUORSULMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.