* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLOSULIDE |
CAS: | 80937-31-1 |
English Synonyms: | FLOSULIDE |
MDL Number.: | MFCD00866141 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CS(=O)(=O)Nc1cc2c(cc1Oc3ccc(cc3F)F)C(=O)CC2 |
InChi: | InChI=1S/C16H13F2NO4S/c1-24(21,22)19-13-6-9-2-4-14(20)11(9)8-16(13)23-15-5-3-10(17)7-12(15)18/h3,5-8,19H,2,4H2,1H3 |
InChiKey: | InChIKey=CXJONBHNIJFARE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.