* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FRADAFIBAN |
CAS: | 148396-36-5 |
English Synonyms: | FRADAFIBAN |
MDL Number.: | MFCD00866174 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1cc(ccc1c2ccc(cc2)OC[C@H]3C[C@H](C(=O)N3)CC(=O)O)C(=N)N |
InChi: | InChI=1S/C20H21N3O4/c21-19(22)14-3-1-12(2-4-14)13-5-7-17(8-6-13)27-11-16-9-15(10-18(24)25)20(26)23-16/h1-8,15-16H,9-11H2,(H3,21,22)(H,23,26)(H,24,25)/t15-,16+/m0/s1 |
InChiKey: | InChIKey=IKZACQMAVUIGPY-JKSUJKDBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.