* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIATHYMOSULFONE |
| CAS: | 5964-62-5 |
| English Synonyms: | DIATHYMOSULFONE |
| MDL Number.: | MFCD00866228 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c(cc1/N=N/c2ccc(cc2)S(=O)(=O)c3ccc(cc3)/N=N/c4cc(c(cc4C)O)C(C)C)C(C)C)O |
| InChi: | InChI=1S/C32H34N4O4S/c1-19(2)27-17-29(21(5)15-31(27)37)35-33-23-7-11-25(12-8-23)41(39,40)26-13-9-24(10-14-26)34-36-30-18-28(20(3)4)32(38)16-22(30)6/h7-20,37-38H,1-6H3/b35-33+,36-34+ |
| InChiKey: | InChIKey=KHFUQWURHSKTPO-LBYUQGKWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.