* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XANTHIOL |
CAS: | 14008-71-0 |
English Synonyms: | XANTHIOL |
MDL Number.: | MFCD00866231 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)C(c3cc(ccc3S2)Cl)CCCN4CCN(CC4)CCCO |
InChi: | InChI=1S/C23H29ClN2OS/c24-18-8-9-23-21(17-18)19(20-5-1-2-7-22(20)28-23)6-3-10-25-12-14-26(15-13-25)11-4-16-27/h1-2,5,7-9,17,19,27H,3-4,6,10-16H2 |
InChiKey: | InChIKey=VQLAZPRVCPICCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.