* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GALOCITABINE |
| CAS: | 124012-42-6 |
| English Synonyms: | GALOCITABINE |
| MDL Number.: | MFCD00866300 |
| H bond acceptor: | 11 |
| H bond donor: | 3 |
| Smile: | C[C@@H]1[C@H]([C@H]([C@@H](O1)n2cc(c(nc2=O)NC(=O)c3cc(c(c(c3)OC)OC)OC)F)O)O |
| InChi: | InChI=1S/C19H22FN3O8/c1-8-13(24)14(25)18(31-8)23-7-10(20)16(22-19(23)27)21-17(26)9-5-11(28-2)15(30-4)12(6-9)29-3/h5-8,13-14,18,24-25H,1-4H3,(H,21,22,26,27)/t8-,13-,14-,18-/m1/s1 |
| InChiKey: | InChIKey=TVYPSLDUBVTDIS-FUOMVGGVSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.