* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MITOTENAMINE |
CAS: | 7696-00-6 |
English Synonyms: | MITOTENAMINE |
MDL Number.: | MFCD00866313 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCN(CCCl)Cc1csc2c1cc(cc2)Br |
InChi: | InChI=1S/C13H15BrClNS/c1-2-16(6-5-15)8-10-9-17-13-4-3-11(14)7-12(10)13/h3-4,7,9H,2,5-6,8H2,1H3 |
InChiKey: | InChIKey=SZLHBBCRNVPTRZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.