* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIRACODAZOLE |
| CAS: | 110883-46-0 |
| English Synonyms: | GIRACODAZOLE ; (1S,2S)-3-AMINO-1-(2-AMINO-1H-IMIDAZOL-4-YL)-2-CHLOROPROPAN-1-OL |
| MDL Number.: | MFCD00866349 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | c1c(nc([nH]1)N)[C@@H]([C@H](CN)Cl)O |
| InChi: | InChI=1S/C6H11ClN4O/c7-3(1-8)5(12)4-2-10-6(9)11-4/h2-3,5,12H,1,8H2,(H3,9,10,11)/t3-,5+/m0/s1 |
| InChiKey: | InChIKey=YILCGOCHVFQMTC-WVZVXSGGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.