* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SUFOSFAMIDE |
| CAS: | 37753-10-9 |
| English Synonyms: | SUFOSFAMIDE |
| MDL Number.: | MFCD00866392 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CS(=O)(=O)OCCNP1(=O)N(CCCO1)CCCl |
| InChi: | InChI=1S/C8H18ClN2O5PS/c1-18(13,14)16-8-4-10-17(12)11(6-3-9)5-2-7-15-17/h2-8H2,1H3,(H,10,12) |
| InChiKey: | InChIKey=ZSZKJARKHWCBJK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.