* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINGLYCINATE |
| CAS: | 865-24-7 |
| English Synonyms: | VINGLYCINATE |
| MDL Number.: | MFCD00866482 |
| H bond acceptor: | 14 |
| H bond donor: | 3 |
| Smile: | CC[C@@]1(C[C@@H]2C[C@@](c3c(c4ccccc4[nH]3)CCN(C2)C1)(c5cc6c(cc5OC)N([C@@H]7[C@]68CCN9[C@H]8[C@@](C=CC9)([C@H]([C@@]7(C(=O)OC)O)OC(=O)CN(C)C)CC)C)C(=O)OC)O |
| InChi: | InChI=1S/C48H63N5O9/c1-9-44(57)24-29-25-47(42(55)60-7,38-31(16-20-52(26-29)28-44)30-14-11-12-15-34(30)49-38)33-22-32-35(23-36(33)59-6)51(5)40-46(32)18-21-53-19-13-17-45(10-2,39(46)53)41(48(40,58)43(56)61-8)62-37(54)27-50(3)4/h11-15,17,22-23,29,39-41,49,57-58H,9-10,16,18-21,24-28H2,1-8H3/t29-,39+,40-,41-,44+,45-,46-,47+,48+/m1/s1 |
| InChiKey: | InChIKey=YNSIUGHLISOIRQ-SWSODSCOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.