* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DEFOSFAMIDE |
| CAS: | 3733-81-1 |
| English Synonyms: | DEFOSFAMIDE |
| MDL Number.: | MFCD00866553 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C(CNP(=O)(N(CCCl)CCCl)OCCCl)CO |
| InChi: | InChI=1S/C9H20Cl3N2O3P/c10-2-6-14(7-3-11)18(16,17-9-4-12)13-5-1-8-15/h15H,1-9H2,(H,13,16) |
| InChiKey: | InChIKey=FQWNGSKQHPNIQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.