* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULNIDAZOLE |
| CAS: | 51022-76-5 |
| English Synonyms: | SULNIDAZOLE |
| MDL Number.: | MFCD00866599 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCc1ncc(n1CCNC(=S)OC)[N+](=O)[O-] |
| InChi: | InChI=1S/C9H14N4O3S/c1-3-7-11-6-8(13(14)15)12(7)5-4-10-9(17)16-2/h6H,3-5H2,1-2H3,(H,10,17) |
| InChiKey: | InChIKey=BDRFWSJMVOBAHR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.