* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINMEGALLATE |
| CAS: | 83482-77-3 |
| English Synonyms: | VINMEGALLATE |
| MDL Number.: | MFCD00866631 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | CC[C@@]12C=CCN3[C@@H]1c4c(c5ccccc5n4C(=C2)COC(=O)c6cc(c(c(c6)OC)OC)OC)CC3 |
| InChi: | InChI=1S/C30H32N2O5/c1-5-30-12-8-13-31-14-11-22-21-9-6-7-10-23(21)32(26(22)28(30)31)20(17-30)18-37-29(33)19-15-24(34-2)27(36-4)25(16-19)35-3/h6-10,12,15-17,28H,5,11,13-14,18H2,1-4H3/t28-,30+/m1/s1 |
| InChiKey: | InChIKey=YBXKKOCGWBHEBM-DGPALRBDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.