* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ELOPIPRAZOLE |
| CAS: | 115464-77-2 |
| English Synonyms: | ELOPIPRAZOLE |
| MDL Number.: | MFCD00866634 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc2ccoc2c(c1)N3CCN(CC3)Cc4ccc([nH]4)c5ccc(cc5)F |
| InChi: | InChI=1S/C23H22FN3O/c24-19-6-4-17(5-7-19)21-9-8-20(25-21)16-26-11-13-27(14-12-26)22-3-1-2-18-10-15-28-23(18)22/h1-10,15,25H,11-14,16H2 |
| InChiKey: | InChIKey=PGNHBJGIQAEIHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.