* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FANANSERIN |
CAS: | 127625-29-0 |
English Synonyms: | FANANSERIN |
MDL Number.: | MFCD00866648 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc2cccc3c2c(c1)N(S3(=O)=O)CCCN4CCN(CC4)c5ccc(cc5)F |
InChi: | InChI=1S/C23H24FN3O2S/c24-19-8-10-20(11-9-19)26-16-14-25(15-17-26)12-3-13-27-21-6-1-4-18-5-2-7-22(23(18)21)30(27,28)29/h1-2,4-11H,3,12-17H2 |
InChiKey: | InChIKey=VGIGHGMPMUCLIQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.