* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SILTENZEPINE |
| CAS: | 98374-54-0 |
| English Synonyms: | SILTENZEPINE |
| MDL Number.: | MFCD00866742 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)C(=O)Nc3cc(ccc3N2C(=O)CN(CCO)CCO)Cl |
| InChi: | InChI=1S/C19H20ClN3O4/c20-13-5-6-17-15(11-13)21-19(27)14-3-1-2-4-16(14)23(17)18(26)12-22(7-9-24)8-10-25/h1-6,11,24-25H,7-10,12H2,(H,21,27) |
| InChiKey: | InChIKey=DDBKYWMANNIJRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.